8,10-dihydroxy-7H-benzo[c]xanthen-7-one
Chemical Structure Depiction of
8,10-dihydroxy-7H-benzo[c]xanthen-7-one
8,10-dihydroxy-7H-benzo[c]xanthen-7-one
Building block characteristics
| Compound ID: | BB55-8511 |
| Compound Name: | 8,10-dihydroxy-7H-benzo[c]xanthen-7-one |
| Molecular Weight: | 278.26 |
| Molecular Formula: | C17 H10 O4 |
| CAS Number: | 53865-02-4 |
| MFCD Number: | MFCD13969027 |
| Smiles: | c1ccc2c(c1)ccc1C(c3c(cc(cc3Oc12)O)O)=O |