ethyl 3-amino-3-(3-chloro-4-methylphenyl)propanoate oxalic acid (1:1)
Chemical Structure Depiction of
ethyl 3-amino-3-(3-chloro-4-methylphenyl)propanoate oxalic acid (1:1)
ethyl 3-amino-3-(3-chloro-4-methylphenyl)propanoate oxalic acid (1:1)
Building block characteristics
| Compound ID: | BB56-0106 |
| Compound Name: | ethyl 3-amino-3-(3-chloro-4-methylphenyl)propanoate oxalic acid (1:1) |
| Molecular Weight: | 241.71 |
| Molecular Formula: | C12 H16 Cl N O2 |
| MFCD Number: | MFCD05861433 |
| Salt: | HOOCCOOH |
| Smiles: | CCOC(CC(c1ccc(C)c(c1)[Cl])N)=O |