4,6-dichloro-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
4,6-dichloro-1H-indole-2-carboxylic acid
4,6-dichloro-1H-indole-2-carboxylic acid
Building block characteristics
| Compound ID: | BB56-0258 |
| Compound Name: | 4,6-dichloro-1H-indole-2-carboxylic acid |
| Molecular Weight: | 230.05 |
| Molecular Formula: | C9 H5 Cl2 N O2 |
| CAS Number: | 101861-63-6 |
| MFCD Number: | MFCD00209870 |
| Smiles: | c1c(cc2c(cc(C(O)=O)[nH]2)c1[Cl])[Cl] |