4-(4-benzylphenyl)-1,3-thiazol-2-amine
Chemical Structure Depiction of
4-(4-benzylphenyl)-1,3-thiazol-2-amine
4-(4-benzylphenyl)-1,3-thiazol-2-amine
Building block characteristics
| Compound ID: | BB56-1019 |
| Compound Name: | 4-(4-benzylphenyl)-1,3-thiazol-2-amine |
| Molecular Weight: | 266.36 |
| Molecular Formula: | C16 H14 N2 S |
| CAS Number: | 68729-05-5 |
| MFCD Number: | MFCD01816130 |
| Smiles: | C(c1ccccc1)c1ccc(cc1)c1csc(N)n1 |