5-[3-(5-aminothiophen-2-yl)propyl]-1,3,4-thiadiazol-2-amine
Chemical Structure Depiction of
5-[3-(5-aminothiophen-2-yl)propyl]-1,3,4-thiadiazol-2-amine
5-[3-(5-aminothiophen-2-yl)propyl]-1,3,4-thiadiazol-2-amine
Building block characteristics
| Compound ID: | BB56-1273 |
| Compound Name: | 5-[3-(5-aminothiophen-2-yl)propyl]-1,3,4-thiadiazol-2-amine |
| Molecular Weight: | 240.35 |
| Molecular Formula: | C9 H12 N4 S2 |
| CAS Number: | 881040-38-6 |
| MFCD Number: | MFCD06653364 |
| Smiles: | C(Cc1ccc(N)s1)Cc1nnc(N)s1 |