5-(4-chloro-3-nitrophenyl)-1,3,4-thiadiazol-2-amine
Chemical Structure Depiction of
5-(4-chloro-3-nitrophenyl)-1,3,4-thiadiazol-2-amine
5-(4-chloro-3-nitrophenyl)-1,3,4-thiadiazol-2-amine
Building block characteristics
| Compound ID: | BB56-1410 |
| Compound Name: | 5-(4-chloro-3-nitrophenyl)-1,3,4-thiadiazol-2-amine |
| Molecular Weight: | 256.67 |
| Molecular Formula: | C8 H5 Cl N4 O2 S |
| CAS Number: | 109702-87-6 |
| MFCD Number: | MFCD00981126 |
| Smiles: | c1cc(c(cc1c1nnc(N)s1)[N+]([O-])=O)[Cl] |