1-(3-chloro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid
Chemical Structure Depiction of
1-(3-chloro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid
1-(3-chloro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid
Building block characteristics
| Compound ID: | BB56-2545 |
| Compound Name: | 1-(3-chloro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid |
| Molecular Weight: | 235.67 |
| Molecular Formula: | C12 H10 Cl N O2 |
| CAS Number: | 952958-69-9 |
| MFCD Number: | MFCD05174707 |
| Smiles: | Cc1ccc(cc1[Cl])n1cccc1C(O)=O |