1-(2-bromo-4-methylphenyl)-1H-pyrrole-2-carboxylic acid
Chemical Structure Depiction of
1-(2-bromo-4-methylphenyl)-1H-pyrrole-2-carboxylic acid
1-(2-bromo-4-methylphenyl)-1H-pyrrole-2-carboxylic acid
Building block characteristics
| Compound ID: | BB56-2612 |
| Compound Name: | 1-(2-bromo-4-methylphenyl)-1H-pyrrole-2-carboxylic acid |
| Molecular Weight: | 280.12 |
| Molecular Formula: | C12 H10 Br N O2 |
| CAS Number: | 952958-79-1 |
| MFCD Number: | MFCD05174682 |
| Smiles: | Cc1ccc(c(c1)[Br])n1cccc1C(O)=O |