1-(4-aminophenyl)-3-(3-chlorophenyl)prop-2-en-1-one
Chemical Structure Depiction of
1-(4-aminophenyl)-3-(3-chlorophenyl)prop-2-en-1-one
1-(4-aminophenyl)-3-(3-chlorophenyl)prop-2-en-1-one
Building block characteristics
| Compound ID: | BB57-0414 |
| Compound Name: | 1-(4-aminophenyl)-3-(3-chlorophenyl)prop-2-en-1-one |
| Molecular Weight: | 257.72 |
| Molecular Formula: | C15 H12 Cl N O |
| MFCD Number: | MFCD09559384 |
| Smiles: | C(=C/c1cccc(c1)[Cl])\C(c1ccc(cc1)N)=O |