1-(4-aminophenyl)-3-(2,3-dimethoxyphenyl)prop-2-en-1-one
Chemical Structure Depiction of
1-(4-aminophenyl)-3-(2,3-dimethoxyphenyl)prop-2-en-1-one
1-(4-aminophenyl)-3-(2,3-dimethoxyphenyl)prop-2-en-1-one
Building block characteristics
| Compound ID: | BB57-0420 |
| Compound Name: | 1-(4-aminophenyl)-3-(2,3-dimethoxyphenyl)prop-2-en-1-one |
| Molecular Weight: | 283.32 |
| Molecular Formula: | C17 H17 N O3 |
| CAS Number: | 807642-54-2 |
| MFCD Number: | MFCD09559389 |
| Smiles: | COc1cccc(/C=C/C(c2ccc(cc2)N)=O)c1OC |