[(2-{[2-(2-fluorophenyl)ethyl]amino}-2-oxoethyl)(4-methoxyphenyl)amino]acetic acid
Chemical Structure Depiction of
[(2-{[2-(2-fluorophenyl)ethyl]amino}-2-oxoethyl)(4-methoxyphenyl)amino]acetic acid
[(2-{[2-(2-fluorophenyl)ethyl]amino}-2-oxoethyl)(4-methoxyphenyl)amino]acetic acid
Building block characteristics
| Compound ID: | BB57-0484 |
| Compound Name: | [(2-{[2-(2-fluorophenyl)ethyl]amino}-2-oxoethyl)(4-methoxyphenyl)amino]acetic acid |
| Molecular Weight: | 360.38 |
| Molecular Formula: | C19 H21 F N2 O4 |
| CAS Number: | 1142215-76-6 |
| MFCD Number: | MFCD12027577 |
| Smiles: | COc1ccc(cc1)N(CC(O)=O)CC(NCCc1ccccc1F)=O |