methyl 5-benzyl-2-(2-cyanoacetamido)thiophene-3-carboxylate
Chemical Structure Depiction of
methyl 5-benzyl-2-(2-cyanoacetamido)thiophene-3-carboxylate
methyl 5-benzyl-2-(2-cyanoacetamido)thiophene-3-carboxylate
Building block characteristics
| Compound ID: | BB57-0659 |
| Compound Name: | methyl 5-benzyl-2-(2-cyanoacetamido)thiophene-3-carboxylate |
| Molecular Weight: | 314.36 |
| Molecular Formula: | C16 H14 N2 O3 S |
| CAS Number: | 515872-97-6 |
| MFCD Number: | MFCD03759462 |
| Smiles: | COC(c1cc(Cc2ccccc2)sc1NC(CC#N)=O)=O |