methyl (4,5-diethoxy-2-nitrophenyl)acetate
Chemical Structure Depiction of
methyl (4,5-diethoxy-2-nitrophenyl)acetate
methyl (4,5-diethoxy-2-nitrophenyl)acetate
Building block characteristics
| Compound ID: | BB57-1446 |
| Compound Name: | methyl (4,5-diethoxy-2-nitrophenyl)acetate |
| Molecular Weight: | 283.28 |
| Molecular Formula: | C13 H17 N O6 |
| CAS Number: | 885452-04-0 |
| MFCD Number: | MFCD06019300 |
| Smiles: | CCOc1cc(CC(=O)OC)c(cc1OCC)[N+]([O-])=O |