methyl 3-(chloromethyl)-4-methoxybenzoate
Chemical Structure Depiction of
methyl 3-(chloromethyl)-4-methoxybenzoate
methyl 3-(chloromethyl)-4-methoxybenzoate
Building block characteristics
| Compound ID: | BB57-2068 |
| Compound Name: | methyl 3-(chloromethyl)-4-methoxybenzoate |
| Molecular Weight: | 214.65 |
| Molecular Formula: | C10 H11 Cl O3 |
| CAS Number: | 36755-02-9 |
| MFCD Number: | MFCD05864592 |
| Smiles: | COC(c1ccc(c(C[Cl])c1)OC)=O |