ethyl 4-(5-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate
Chemical Structure Depiction of
ethyl 4-(5-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate
ethyl 4-(5-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate
Building block characteristics
| Compound ID: | BB57-2071 |
| Compound Name: | ethyl 4-(5-fluoro-2-methoxyphenyl)-2,4-dioxobutanoate |
| Molecular Weight: | 268.24 |
| Molecular Formula: | C13 H13 F O5 |
| CAS Number: | 1225574-45-7 |
| MFCD Number: | MFCD16338212 |
| Smiles: | CCOC(C(CC(c1cc(ccc1OC)F)=O)=O)=O |