2-bromo-2-methyl-N-phenylpropanamide
Chemical Structure Depiction of
2-bromo-2-methyl-N-phenylpropanamide
2-bromo-2-methyl-N-phenylpropanamide
Building block characteristics
| Compound ID: | BB57-2737 |
| Compound Name: | 2-bromo-2-methyl-N-phenylpropanamide |
| Molecular Weight: | 242.11 |
| Molecular Formula: | C10 H12 Br N O |
| CAS Number: | 2322-45-4 |
| MFCD Number: | MFCD02751707 |
| Smiles: | CC(C)(C(Nc1ccccc1)=O)[Br] |