2-bromo-N-(4-butoxyphenyl)-2-methylpropanamide
Chemical Structure Depiction of
2-bromo-N-(4-butoxyphenyl)-2-methylpropanamide
2-bromo-N-(4-butoxyphenyl)-2-methylpropanamide
Building block characteristics
| Compound ID: | BB57-2741 |
| Compound Name: | 2-bromo-N-(4-butoxyphenyl)-2-methylpropanamide |
| Molecular Weight: | 314.22 |
| Molecular Formula: | C14 H20 Br N O2 |
| MFCD Number: | MFCD22056623 |
| Smiles: | CCCCOc1ccc(cc1)NC(C(C)(C)[Br])=O |