3-chloro-1-(10H-phenothiazin-10-yl)propan-1-one
Chemical Structure Depiction of
3-chloro-1-(10H-phenothiazin-10-yl)propan-1-one
3-chloro-1-(10H-phenothiazin-10-yl)propan-1-one
Building block characteristics
| Compound ID: | BB57-2800 |
| Compound Name: | 3-chloro-1-(10H-phenothiazin-10-yl)propan-1-one |
| Molecular Weight: | 289.78 |
| Molecular Formula: | C15 H12 Cl N O S |
| CAS Number: | 4091-91-2 |
| MFCD Number: | MFCD01541604 |
| Smiles: | C(C[Cl])C(N1c2ccccc2Sc2ccccc12)=O |