bis(2-hydroxyphenyl)methanone
Chemical Structure Depiction of
bis(2-hydroxyphenyl)methanone
bis(2-hydroxyphenyl)methanone
Building block characteristics
| Compound ID: | BB57-4853 |
| Compound Name: | bis(2-hydroxyphenyl)methanone |
| Molecular Weight: | 214.22 |
| Molecular Formula: | C13 H10 O3 |
| CAS Number: | 835-11-0 |
| MFCD Number: | MFCD00002217 |
| Smiles: | c1ccc(c(c1)C(c1ccccc1O)=O)O |