N-[(adamantan-1-yl)methyl]-2-chloroacetamide
Chemical Structure Depiction of
N-[(adamantan-1-yl)methyl]-2-chloroacetamide
N-[(adamantan-1-yl)methyl]-2-chloroacetamide
Building block characteristics
| Compound ID: | BB57-5716 |
| Compound Name: | N-[(adamantan-1-yl)methyl]-2-chloroacetamide |
| Molecular Weight: | 241.76 |
| Molecular Formula: | C13 H20 Cl N O |
| MFCD Number: | MFCD01837495 |
| Smiles: | C1C2CC3CC1CC(C2)(C3)CNC(C[Cl])=O |