N-[2-(2,5-dichlorophenoxy)ethyl]acetamide
Chemical Structure Depiction of
N-[2-(2,5-dichlorophenoxy)ethyl]acetamide
N-[2-(2,5-dichlorophenoxy)ethyl]acetamide
Building block characteristics
| Compound ID: | BB57-5745 |
| Compound Name: | N-[2-(2,5-dichlorophenoxy)ethyl]acetamide |
| Molecular Weight: | 248.11 |
| Molecular Formula: | C10 H11 Cl2 N O2 |
| CAS Number: | 1188262-61-4 |
| MFCD Number: | MFCD13704304 |
| Smiles: | CC(NCCOc1cc(ccc1[Cl])[Cl])=O |