methyl [2-(4-tert-butylphenoxy)ethyl]carbamate
Chemical Structure Depiction of
methyl [2-(4-tert-butylphenoxy)ethyl]carbamate
methyl [2-(4-tert-butylphenoxy)ethyl]carbamate
Building block characteristics
| Compound ID: | BB57-5898 |
| Compound Name: | methyl [2-(4-tert-butylphenoxy)ethyl]carbamate |
| Molecular Weight: | 251.32 |
| Molecular Formula: | C14 H21 N O3 |
| CAS Number: | 690668-81-6 |
| MFCD Number: | MFCD05984706 |
| Smiles: | CC(C)(C)c1ccc(cc1)OCCNC(=O)OC |