diethyl [cyano(phenyl)methyl]propanedioate
Chemical Structure Depiction of
diethyl [cyano(phenyl)methyl]propanedioate
diethyl [cyano(phenyl)methyl]propanedioate
Building block characteristics
| Compound ID: | BB57-6488 |
| Compound Name: | diethyl [cyano(phenyl)methyl]propanedioate |
| Molecular Weight: | 275.3 |
| Molecular Formula: | C15 H17 N O4 |
| CAS Number: | 185067-05-4 |
| MFCD Number: | MFCD00092181 |
| Smiles: | CCOC(C(C(C#N)c1ccccc1)C(=O)OCC)=O |