2-bromo-2-(4-chlorophenyl)-1H-indene-1,3(2H)-dione
Chemical Structure Depiction of
2-bromo-2-(4-chlorophenyl)-1H-indene-1,3(2H)-dione
2-bromo-2-(4-chlorophenyl)-1H-indene-1,3(2H)-dione
Building block characteristics
| Compound ID: | BB58-0161 |
| Compound Name: | 2-bromo-2-(4-chlorophenyl)-1H-indene-1,3(2H)-dione |
| Molecular Weight: | 335.58 |
| Molecular Formula: | C15 H8 Br Cl O2 |
| CAS Number: | 730-73-4 |
| MFCD Number: | MFCD00183009 |
| Smiles: | c1ccc2C(C(C(c2c1)=O)(c1ccc(cc1)[Cl])[Br])=O |