2,3-dibromo-4,5,6,7-tetrahydro-1-benzothiophene
Chemical Structure Depiction of
2,3-dibromo-4,5,6,7-tetrahydro-1-benzothiophene
2,3-dibromo-4,5,6,7-tetrahydro-1-benzothiophene
Building block characteristics
| Compound ID: | BB58-0530 |
| Compound Name: | 2,3-dibromo-4,5,6,7-tetrahydro-1-benzothiophene |
| Molecular Weight: | 296.02 |
| Molecular Formula: | C8 H8 Br2 S |
| CAS Number: | 1785762-03-9 |
| MFCD Number: | MFCD25368884 |
| Smiles: | C1CCc2c(C1)c(c(s2)[Br])[Br] |