[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methanol
Chemical Structure Depiction of
[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methanol
[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methanol
Building block characteristics
| Compound ID: | BB58-1140 |
| Compound Name: | [5-(2-methoxy-5-nitrophenyl)furan-2-yl]methanol |
| Molecular Weight: | 249.22 |
| Molecular Formula: | C12 H11 N O5 |
| MFCD Number: | MFCD09754666 |
| Smiles: | COc1ccc(cc1c1ccc(CO)o1)[N+]([O-])=O |