2-chloro-5-(propan-2-yl)-1,3-thiazole-4-carboxylic acid
Chemical Structure Depiction of
2-chloro-5-(propan-2-yl)-1,3-thiazole-4-carboxylic acid
2-chloro-5-(propan-2-yl)-1,3-thiazole-4-carboxylic acid
Building block characteristics
| Compound ID: | BB58-1432 |
| Compound Name: | 2-chloro-5-(propan-2-yl)-1,3-thiazole-4-carboxylic acid |
| Molecular Weight: | 205.66 |
| Molecular Formula: | C7 H8 Cl N O2 S |
| CAS Number: | 886360-70-9 |
| MFCD Number: | MFCD03791228 |
| Smiles: | CC(C)c1c(C(O)=O)nc(s1)[Cl] |