2-amino-5-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid
Chemical Structure Depiction of
2-amino-5-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid
2-amino-5-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid
Building block characteristics
| Compound ID: | BB58-1437 |
| Compound Name: | 2-amino-5-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid |
| Molecular Weight: | 254.69 |
| Molecular Formula: | C10 H7 Cl N2 O2 S |
| CAS Number: | 886361-44-0 |
| MFCD Number: | MFCD06200928 |
| Smiles: | c1ccc(c(c1)c1c(C(O)=O)nc(N)s1)[Cl] |