1-(2-methoxyethyl)-1H-indole-4-carboxylic acid
Chemical Structure Depiction of
1-(2-methoxyethyl)-1H-indole-4-carboxylic acid
1-(2-methoxyethyl)-1H-indole-4-carboxylic acid
Building block characteristics
| Compound ID: | BB58-1773 |
| Compound Name: | 1-(2-methoxyethyl)-1H-indole-4-carboxylic acid |
| Molecular Weight: | 219.24 |
| Molecular Formula: | C12 H13 N O3 |
| CAS Number: | 1096306-76-1 |
| MFCD Number: | MFCD11641383 |
| Smiles: | COCCn1ccc2c(cccc12)C(O)=O |