4-{[N-(2-fluorophenyl)(dimethyl)sulfamamido]methyl}benzoic acid
Chemical Structure Depiction of
4-{[N-(2-fluorophenyl)(dimethyl)sulfamamido]methyl}benzoic acid
4-{[N-(2-fluorophenyl)(dimethyl)sulfamamido]methyl}benzoic acid
Building block characteristics
| Compound ID: | BB58-2630 |
| Compound Name: | 4-{[N-(2-fluorophenyl)(dimethyl)sulfamamido]methyl}benzoic acid |
| Molecular Weight: | 352.38 |
| Molecular Formula: | C16 H17 F N2 O4 S |
| MFCD Number: | MFCD18170153 |
| Smiles: | CN(C)S(N(Cc1ccc(cc1)C(O)=O)c1ccccc1F)(=O)=O |