6-methyl-5-phenylthieno[2,3-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
6-methyl-5-phenylthieno[2,3-d]pyrimidin-4(3H)-one
6-methyl-5-phenylthieno[2,3-d]pyrimidin-4(3H)-one
Building block characteristics
| Compound ID: | BB58-5265 |
| Compound Name: | 6-methyl-5-phenylthieno[2,3-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 242.3 |
| Molecular Formula: | C13 H10 N2 O S |
| MFCD Number: | MFCD01462066 |
| Smiles: | Cc1c(c2ccccc2)c2C(NC=Nc2s1)=O |