Diphenylpyraline hydrochloride
Chemical Structure Depiction of
Diphenylpyraline hydrochloride
Diphenylpyraline hydrochloride
Compound characteristics
| Compound ID: | CE01-0086 |
| Compound Name: | Diphenylpyraline hydrochloride |
| Molecular Weight: | 317.86 |
| Molecular Formula: | C19 H23 N O.H Cl |
| CAS Number: | 132-18-3 |
| Smiles: | CN1CCC(CC1)OC(c1ccccc1)c1ccccc1.[Cl] |
| InChI Key: | LPRLDRXGWKXRMQ-UHFFFAOYSA-N |
| Short Description: | Diphenylpyraline hydrochloride (4-Diphenylmethoxy-1-methylpiperidine hydrochloride) is used in the treatment of Parkinsonism.It is a first-generation antihistamine with anticholinergic effects, functi ons as a dopamine reuptake inhibitor. |
| Pathway: | Immunology/Inflammation|||GPCR/G Protein|||Neuroscience |
| Target: | Histamine Receptor |
| Type of molecule: | FDA Approved |
| Alias: | 4-Diphenylmethoxy-1-methylpiperidine hydrochloride |
| Stock amount: | 1664 |