Dibucaine hydrochloride
Chemical Structure Depiction of
Dibucaine hydrochloride
Dibucaine hydrochloride
Compound characteristics
| Compound ID: | CE01-0417 |
| Compound Name: | Dibucaine hydrochloride |
| Molecular Weight: | 379.93 |
| Molecular Formula: | C20 H29 N3 O2.H Cl |
| CAS Number: | 61-12-1 |
| Smiles: | CCCCOc1cc(C(NCCN(CC)CC)=O)c2ccccc2n1.[Cl] |
| InChI Key: | IVHBBMHQKZBJEU-UHFFFAOYSA-N |
| Short Description: | Dibucaine hydrochloride (Cinchocaine hydrochloride), a long-acting local amide anestheticsis, is usually used for surface anesthesia. |
| Pathway: | Membrane transporter/Ion channel|||Neuroscience |
| Target: | Sodium Channel|||AChR |
| Type of molecule: | FDA Approved |
| Alias: | Cinchocaine hydrochloride , Cinchocaine HCl , Dibucaine HCl |
| Stock amount: | 3657 |