Venlafaxine hydrochloride
Chemical Structure Depiction of
Venlafaxine hydrochloride
Venlafaxine hydrochloride
Compound characteristics
| Compound ID: | CE01-0535 |
| Compound Name: | Venlafaxine hydrochloride |
| Molecular Weight: | 313.87 |
| Molecular Formula: | C17 H27 N O2.H Cl |
| CAS Number: | 99300-78-4 |
| Smiles: | CN(C)CC(c1ccc(cc1)OC)C1(CCCCC1)O.[Cl] |
| InChI Key: | QYRYFNHXARDNFZ-PKLMIRHRSA-N |
| Short Description: | Venlafaxine hydrochloride (Wy 45030 hydrochloride) is a cyclohexanol and phenylethylamine derivative that functions as a SEROTONIN AND NORADRENALINE REUPTAKE INHIBITOR (SNRI) and is used as an ANTIDEP RESSIVE AGENT. |
| Pathway: | Neuroscience|||GPCR/G Protein |
| Target: | 5-HT Receptor|||Serotonin Transporter |
| Type of molecule: | FDA Approved/Clinical |
| Alias: | Venlafaxine HCl , Wy 45030 hydrochloride |
| Stock amount: | 1793 |