1-(3-Chlorophenyl)piperazine hydrochloride
Chemical Structure Depiction of
1-(3-Chlorophenyl)piperazine hydrochloride
1-(3-Chlorophenyl)piperazine hydrochloride
Compound characteristics
| Compound ID: | CE01-0668 |
| Compound Name: | 1-(3-Chlorophenyl)piperazine hydrochloride |
| Molecular Weight: | 233.14 |
| Molecular Formula: | C10 H13 Cl N2.H Cl |
| CAS Number: | 13078-15-4 |
| Smiles: | C1CN(CCN1)c1cccc(c1)[Cl].[Cl] |
| InChI Key: | MHXPYWFZULXYHT-UHFFFAOYSA-N |
| Short Description: | 1-(3-Chlorophenyl)piperazine hydrochloride (M-CPP hydrochloride) is used for the synthesis of trazodone, Etoperidone, Nefazodone, etc. |
| Pathway: | Others |
| Target: | Others |
| Alias: | M-CPP hydrochloride |
| Stock amount: | 4436 |