Banoxantrone dihydrochloride
Chemical Structure Depiction of
Banoxantrone dihydrochloride
Banoxantrone dihydrochloride
Compound characteristics
| Compound ID: | CE01-1539 |
| Compound Name: | Banoxantrone dihydrochloride |
| Molecular Weight: | 517.41 |
| Molecular Formula: | C22 H28 N4 O6.H Cl.H Cl |
| CAS Number: | 252979-56-9 |
| Smiles: | C[N+](C)(CCNc1ccc(c2C(c3c(ccc(c3C(c12)=O)O)O)=O)NCC[N+](C)(C)[O-])[O-].[Cl].[Cl] |
| InChI Key: | SBWCPHUXRZRTDP-UHFFFAOYSA-N |
| Short Description: | Banoxantrone dihydrochloride (AQ4N dihydrochloride) is a novel hypoxic cytotoxin that selectively kills hypoxic cells through an iNOS-dependent mechanism. |
| Pathway: | Immunology/Inflammation |
| Target: | NOS |
| Type of molecule: | Clinical |
| Alias: | AQ4N dihydrochloride , AZD1689 2HCl |
| Stock amount: | 2165 |