Salbutamol
Chemical Structure Depiction of
Salbutamol
Salbutamol
Compound characteristics
| Compound ID: | CE01-2603 |
| Compound Name: | Salbutamol |
| Molecular Weight: | 239.31 |
| Molecular Formula: | C13 H21 N O3 |
| CAS Number: | 18559-94-9 |
| Smiles: | CC(C)(C)NCC(c1ccc(c(CO)c1)O)O |
| InChI Key: | NDAUXUAQIAJITI-LBPRGKRZSA-N |
| Short Description: | Salbutamol (Albuterol) stimulates beta2-adrenergic receptors in the lungs, thereby activating the enzyme adenylate cyclase that catalyzes the conversion of ATP to cyclic-3', 5'-adenosine monophosphate (cAMP). Salbutamol Sulfate is the sulfate salt of the short-acting sympathomimetic agent albuterol, a 1:1 racemic mixture of (R)-albuterol and (S)-albuterol with bronchodilator activity. Increased cA MP concentrations relax the bronchial smooth muscle, relieve bronchospasms, and reduce inflammatory cell mediator release, especially from mast cells. To a lesser extent, Salbutamol stimulates beta1-a drenergic receptors, thereby increasing the force and rate of myocardial contraction. |
| Pathway: | Neuroscience|||GPCR/G Protein |
| Target: | Adrenergic Receptor |
| Type of molecule: | FDA Approved/Clinical |
| Alias: | Albuterol , AH-3365 |
| Stock amount: | 7265 |