GW311616 hydrochloride
Chemical Structure Depiction of
GW311616 hydrochloride
GW311616 hydrochloride
Compound characteristics
| Compound ID: | CE01-2759 |
| Compound Name: | GW311616 hydrochloride |
| Molecular Weight: | 434 |
| Molecular Formula: | C19 H31 N3 O4 S.H Cl |
| CAS Number: | 197890-44-1 |
| Smiles: | [H][C@]12[C@@H](C(N([C@]1([H])CCN2C(/C=C/CN1CCCCC1)=O)S(C)(=O)=O)=O)[C@H](C)C.[Cl] |
| InChI Key: | UFCZUKYPBPXODT-ZDJZOQRLSA-N |
| Short Description: | GW-311616 hydrochloride is a long duration, orally bioavailable, and selective human neutrophil elastase (HNE) inhibitor (IC50: 22 nM; Ki: 0.31 nM). |
| Pathway: | Others |
| Target: | Others |
| Alias: | GW311616A |
| Stock amount: | 100 |