K-Ras G12C-IN-3
Chemical Structure Depiction of
K-Ras G12C-IN-3
K-Ras G12C-IN-3
Compound characteristics
| Compound ID: | CE01-2995 |
| Compound Name: | K-Ras G12C-IN-3 |
| Molecular Weight: | 453.75 |
| Molecular Formula: | C21 H19 Cl3 N2 O3 |
| CAS Number: | 1629268-19-4 |
| Smiles: | COc1cc(c(cc1C(N1CCN(CC1)C(C=C)=O)=O)c1cc(ccc1[Cl])[Cl])[Cl] |
| InChI Key: | RPBHAPLCWWQJAK-UHFFFAOYSA-N |
| Short Description: | Heterocyclic compounds as covalent inhibitors of G12C mutant K-Ras protein useful for treating cancers.K-Ras G12C-IN-3 is a novel and irreversible inhibitor of mutant K-ras G12C. |
| Pathway: | Others |
| Target: | Others |
| Stock amount: | 100 |