Kanosamine hydrochloride
Chemical Structure Depiction of
Kanosamine hydrochloride
Kanosamine hydrochloride
Compound characteristics
| Compound ID: | CE01-3003 |
| Compound Name: | Kanosamine hydrochloride |
| Molecular Weight: | 215.63 |
| Molecular Formula: | C6 H13 N O5.H Cl |
| CAS Number: | 57649-10-2 |
| Smiles: | C([C@H]([C@H]([C@@H]([C@H](C=O)O)N)O)O)O.[Cl] |
| InChI Key: | ADFOMBKCPIMCOO-BTVCFUMJSA-N |
| Short Description: | Kanosamine hydrochloride is an antibiotic which inhibits the growth of plant-pathogenic oomycetes, certain fungi and a few bacterial species. Kanosamine inhibits Phytophthora medicaginis M2913 and Aph anomyces euteiches WI-98 with MICs of 25 and 60 mug/mL, respectively. |
| Pathway: | PI3K/Akt/mTOR signaling|||Cytoskeletal Signaling |
| Target: | Akt |
| Stock amount: | 25 |