Lesopitron dihydrochloride
Chemical Structure Depiction of
Lesopitron dihydrochloride
Lesopitron dihydrochloride
Compound characteristics
| Compound ID: | CE01-3114 |
| Compound Name: | Lesopitron dihydrochloride |
| Molecular Weight: | 393.74 |
| Molecular Formula: | C15 H21 Cl N6.H Cl.H Cl |
| CAS Number: | 132449-89-9 |
| Smiles: | C(CCn1cc(cn1)[Cl])CN1CCN(CC1)c1ncccn1.[Cl].[Cl] |
| InChI Key: | RGDLQJUAYQRGBC-UHFFFAOYSA-N |
| Short Description: | Lesopitron dihydrochloride with IC50 of 125 nM in rat hippocampal membranes, is a full and selective 5-HT1A receptor agonist. |
| Pathway: | GPCR/G Protein|||Neuroscience |
| Target: | 5-HT Receptor |
| Alias: | E4424 |
| Stock amount: | 100 |