Necrostatin 2
Chemical Structure Depiction of
Necrostatin 2
Necrostatin 2
Compound characteristics
| Compound ID: | CE01-3511 |
| Compound Name: | Necrostatin 2 |
| Molecular Weight: | 277.71 |
| Molecular Formula: | C13 H12 Cl N3 O2 |
| CAS Number: | 852391-19-6 |
| Smiles: | CN1C([C@@H](Cc2c[nH]c3c(cccc23)[Cl])NC1=O)=O |
| InChI Key: | WIKGAEMMNQTUGL-SNVBAGLBSA-N |
| Short Description: | Necrostatin 2 is an effective necroptosis inhibitor. Necrostatin 2 is also a RIPK1 inhibitor. EC50 for inhibition of necroptosis in FADD-deficient Jurkat T cells treated with TNF-alpha is 0.05 muM. |
| Pathway: | Others |
| Target: | Others |
| Stock amount: | 5 |