Tyrphostin AG1433
Chemical Structure Depiction of
Tyrphostin AG1433
Tyrphostin AG1433
Compound characteristics
| Compound ID: | CE01-7162 |
| Compound Name: | Tyrphostin AG1433 |
| Molecular Weight: | 266.3 |
| Molecular Formula: | C16 H14 N2 O2 |
| CAS Number: | 168835-90-3 |
| Smiles: | Cc1cc2c(cc1C)nc(cn2)c1ccc(c(c1)O)O |
| InChI Key: | SMKFYHOKXJUJOT-UHFFFAOYSA-N |
| Short Description: | Tyrphostin AG1433 (AG1433) is an inhibitor of tyrosine kinases and also a dual inhibitor of PDGFRbeta(IC50s = 5.0 muM) and VEGFR-2 (Flk-1/KDR)(IC50s = 9.3 muM). |
| Pathway: | Tyrosine Kinase/Adaptors|||Angiogenesis |
| Target: | VEGFR|||PDGFR |
| Alias: | SU1433 , AG1433 |
| Stock amount: | 5034 |