Valemetostat tosylate
Chemical Structure Depiction of
Valemetostat tosylate
Valemetostat tosylate
Compound characteristics
| Compound ID: | CE01-7208 |
| Compound Name: | Valemetostat tosylate |
| Molecular Weight: | 660.23 |
| Molecular Formula: | C26 H34 Cl N3 O4.C7 H8 O3 S |
| CAS Number: | 1809336-93-3 |
| Smiles: | [H][C@]1(CC[C@H](CC1)N(C)C)[C@@]1(C)Oc2c(cc(C(NCC3=C(C)C=C(C)NC3=O)=O)c(C)c2O1)[Cl].Cc1ccc(cc1)S(O)(=O)=O |
| InChI Key: | JSBKGJUYSLVFPF-RRKMXGHKSA-N |
| Short Description: | Valemetostat tosylate is a dual inhibitor of EZH1/2 and used in the research of relapsed/refractory peripheral T-cell lymphoma. |
| Pathway: | Chromatin/Epigenetic |
| Target: | Histone Methyltransferase |
| Alias: | DS-3201 tosylate |
| Stock amount: | 100 |