Fmoc-1,6-diaminohexane hydrochloride
Chemical Structure Depiction of
Fmoc-1,6-diaminohexane hydrochloride
Fmoc-1,6-diaminohexane hydrochloride
Compound characteristics
| Compound ID: | CE01-7662 |
| Compound Name: | Fmoc-1,6-diaminohexane hydrochloride |
| Molecular Weight: | 374.91 |
| Molecular Formula: | C21 H26 N2 O2.H Cl |
| CAS Number: | 945923-91-1 |
| Smiles: | [H][Cl].C(CCCNC(=O)OCC1c2ccccc2c2ccccc12)CCN |
| InChI Key: | SKDQIWLYPJOUMY-UHFFFAOYSA-N |
| Short Description: | Fmoc-1,6-diaminohexane hydrochloride is an analog of Osw-1 which has the potential for Alzheimer's disease and cancer treatment. |
| Pathway: | Others |
| Target: | Others |
| Stock amount: | 979 |