Gypenoside XIII
Chemical Structure Depiction of
Gypenoside XIII
Gypenoside XIII
Compound characteristics
| Compound ID: | CE01-7688 |
| Compound Name: | Gypenoside XIII |
| Molecular Weight: | 755 |
| Molecular Formula: | C41 H70 O12 |
| CAS Number: | 80325-22-0 |
| Smiles: | [H][C@@]1(CC[C@]2(C)[C@]1([H])[C@@H](C[C@]1([H])[C@@]3(C)CC[C@@H](C(C)(C)[C@]3([H])CC[C@]12C)O)O)[C@](C)(CCC=C(C)C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O1)O)O)O |
| InChI Key: | YNBYFOIDLBTOMW-ULPAQVJCSA-N |
| Short Description: | Gypenoside XIII is belonging to the gypenosides. Gypenosides, extracted from Gynostemma pentaphyllum, protect against cardiovascular diseases, especially atherosclerosis. |
| Pathway: | Others |
| Target: | Others |
| Stock amount: | 10 |