A-3 hydrochloride
Chemical Structure Depiction of
A-3 hydrochloride
A-3 hydrochloride
Compound characteristics
| Compound ID: | CE01-8050 |
| Compound Name: | A-3 hydrochloride |
| Molecular Weight: | 321.22 |
| Molecular Formula: | C12 H13 Cl N2 O2 S.H Cl |
| CAS Number: | 78957-85-4 |
| Smiles: | C(CNS(c1cccc2c(cccc12)[Cl])(=O)=O)N.[Cl] |
| InChI Key: | VWAGIWCLJAQLAL-UHFFFAOYSA-N |
| Short Description: | A-3 hydrochloride is a potent, cell-permeable, reversible, ATP-competitive non-selective antagonist of various kinases. A-3 hydrochloride also inhibits PKC and casein kinase I with Ki values of 47 muM and 80 muM, respectively[1]. A-3 hydrochloride against PKA (Ki=4.3 muM), casein kinase II (Ki=5.1 muM) and myosin light chain kinase (MLCK) (Ki=7.4 muM). |
| Pathway: | Cytoskeletal Signaling|||Stem Cells|||Chromatin/Epigenetic|||Neuroscience|||Metabolism|||Tyrosine Kinase/Adaptors |
| Target: | PKA|||PKC|||CaMK|||Casein Kinase |
| Stock amount: | 977 |