Rociletinib hydrobromide
Chemical Structure Depiction of
Rociletinib hydrobromide
Rociletinib hydrobromide
Compound characteristics
| Compound ID: | CE01-9016 |
| Compound Name: | Rociletinib hydrobromide |
| Molecular Weight: | 636.47 |
| Molecular Formula: | C27 H28 F3 N7 O3.H Br |
| CAS Number: | 1446700-26-0 |
| Smiles: | CC(N1CCN(CC1)c1ccc(c(c1)OC)Nc1ncc(c(Nc2cccc(c2)NC(C=C)=O)n1)C(F)(F)F)=O.[Br] |
| InChI Key: | IPKRDUJIGYXXNT-UHFFFAOYSA-N |
| Short Description: | Rociletinib hydrobromide is an orally delivered inhibitor of the mutant form of EGFR kinase (Kis: 21.5 nM and 303.3 nM for EGFR L858R/T790M and EGFR WT). |
| Pathway: | Others |
| Target: | Others |
| Alias: | AVL-301 hydrobromide , CO-1686 (hydrobromide) , CNX-419 hydrobromide |
| Stock amount: | 10 |