Olmesartan Medoxomil
Chemical Structure Depiction of
Olmesartan Medoxomil
Olmesartan Medoxomil
Compound characteristics
| Compound ID: | CE01-9216 |
| Compound Name: | Olmesartan Medoxomil |
| Molecular Weight: | 558.59 |
| Molecular Formula: | C29 H30 N6 O6 |
| CAS Number: | 144689-63-4 |
| Smiles: | CCCc1nc(c(C(=O)OCC2=C(C)OC(=O)O2)n1Cc1ccc(cc1)c1ccccc1c1nnn[nH]1)C(C)(C)O |
| InChI Key: | UQGKUQLKSCSZGY-UHFFFAOYSA-N |
| Short Description: | Olmesartan Medoxomil (Benicar) is an angiotensin II type 1 receptor blocker that is used to manage hypertension. |
| Pathway: | Endocrinology/Hormones |
| Target: | RAAS |
| Type of molecule: | FDA Approved |
| Alias: | Benicar , CS 866 |
| Stock amount: | 6530 |