Glycerol phenylbutyrate
Chemical Structure Depiction of
Glycerol phenylbutyrate
Glycerol phenylbutyrate
Compound characteristics
| Compound ID: | CE01-9448 |
| Compound Name: | Glycerol phenylbutyrate |
| Molecular Weight: | 530.66 |
| Molecular Formula: | C33 H38 O6 |
| CAS Number: | 611168-24-2 |
| Smiles: | C(CC(=O)OCC(COC(CCCc1ccccc1)=O)OC(CCCc1ccccc1)=O)Cc1ccccc1 |
| InChI Key: | ZSDBFLMJVAGKOU-UHFFFAOYSA-N |
| Short Description: | Glycerol phenylbutyrate (HPN-100) (GPB) is a new generation ammonia scavenger drug and it also is a sigma-2 (sigma2) receptor ligand (pKi: 8.02). |
| Pathway: | GPCR/G Protein |
| Target: | Sigma receptor |
| Type of molecule: | FDA Approved/Clinical |
| Alias: | HPN-100 |
| Stock amount: | 4065 |